C20H43N3O5S2 — CID 163281773
[3-(4-aminobutoxymethyldisulfanyl)-3-methylbutyl] N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 163281773) has the molecular formula C20H43N3O5S2 and a molecular weight of 469.71 g/mol. Its IUPAC name is [3-(4-aminobutoxymethyldisulfanyl)-3-methylbutyl] N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | [3-(4-aminobutoxymethyldisulfanyl)-3-methylbutyl] N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 163281773 |
| Molecular Formula | C20H43N3O5S2 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | [3-(4-aminobutoxymethyldisulfanyl)-3-methylbutyl] N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)NCCOCCOCCNC(=O)OCCC(C)(C)SSCOCCCCN |
| InChI | InChI=1S/C20H43N3O5S2/c1-18(2)22-9-13-25-15-16-26-14-10-23-19(24)28-12-7-20(3,4)30-29-17-27-11-6-5-8-21/h18,22H,5-17,21H2,1-4H3,(H,23,24) |
| InChIKey | ZVRIDCJIROBBRS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|