C23H44N4O6S2 — CID 170111240
[3-[4-(but-2-ynylcarbamoylamino)butoxymethyldisulfanyl]-3-methylbutyl] N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 170111240) has the molecular formula C23H44N4O6S2 and a molecular weight of 536.76 g/mol. Its IUPAC name is [3-[4-(but-2-ynylcarbamoylamino)butoxymethyldisulfanyl]-3-methylbutyl] N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | [3-[4-(but-2-ynylcarbamoylamino)butoxymethyldisulfanyl]-3-methylbutyl] N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 170111240 |
| Molecular Formula | C23H44N4O6S2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | [3-[4-(but-2-ynylcarbamoylamino)butoxymethyldisulfanyl]-3-methylbutyl] N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC#CCNC(=O)NCCCCOCSSC(C)(C)CCOC(=O)NCCOCCOCCNC |
| InChI | InChI=1S/C23H44N4O6S2/c1-5-6-10-25-21(28)26-11-7-8-14-32-20-34-35-23(2,3)9-15-33-22(29)27-13-17-31-19-18-30-16-12-24-4/h24H,7-20H2,1-4H3,(H,27,29)(H2,25,26,28) |
| InChIKey | FRVRTVSFOLOLTC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|