C25H52N2O5S2 — CID 159439451
[3-methyl-3-[1-[4-(propan-2-ylamino)butoxy]ethyldisulfanyl]butyl] N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]carbamate (PubChem CID 159439451) has the molecular formula C25H52N2O5S2 and a molecular weight of 524.83 g/mol. Its IUPAC name is [3-methyl-3-[1-[4-(propan-2-ylamino)butoxy]ethyldisulfanyl]butyl] N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]carbamate.
| Compound Name | [3-methyl-3-[1-[4-(propan-2-ylamino)butoxy]ethyldisulfanyl]butyl] N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 159439451 |
| Molecular Formula | C25H52N2O5S2 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | [3-methyl-3-[1-[4-(propan-2-ylamino)butoxy]ethyldisulfanyl]butyl] N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]carbamate |
| SMILES | CC(C)CCCOCCOCCNC(=O)OCCC(C)(C)SSC(C)OCCCCNC(C)C |
| InChI | InChI=1S/C25H52N2O5S2/c1-21(2)11-10-15-29-19-20-30-18-14-27-24(28)32-17-12-25(6,7)34-33-23(5)31-16-9-8-13-26-22(3)4/h21-23,26H,8-20H2,1-7H3,(H,27,28) |
| InChIKey | ZNRLVZRPSVDNOH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|