C26H49N3O7S2 — CID 155048652
[3-methyl-3-[1-[4-(4-methylpent-2-ynylcarbamoyloxy)butoxy]ethyldisulfanyl]butyl] N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 155048652) has the molecular formula C26H49N3O7S2 and a molecular weight of 579.83 g/mol. Its IUPAC name is [3-methyl-3-[1-[4-(4-methylpent-2-ynylcarbamoyloxy)butoxy]ethyldisulfanyl]butyl] N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | [3-methyl-3-[1-[4-(4-methylpent-2-ynylcarbamoyloxy)butoxy]ethyldisulfanyl]butyl] N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 155048652 |
| Molecular Formula | C26H49N3O7S2 |
| Molecular Weight | 579.83 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | [3-methyl-3-[1-[4-(4-methylpent-2-ynylcarbamoyloxy)butoxy]ethyldisulfanyl]butyl] N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CNCCOCCOCCNC(=O)OCCC(C)(C)SSC(C)OCCCCOC(=O)NCC#CC(C)C |
| InChI | InChI=1S/C26H49N3O7S2/c1-22(2)10-9-12-28-24(30)35-16-8-7-15-34-23(3)37-38-26(4,5)11-17-36-25(31)29-14-19-33-21-20-32-18-13-27-6/h22-23,27H,7-8,11-21H2,1-6H3,(H,28,30)(H,29,31) |
| InChIKey | JBBBXAKXEKUTTE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|