C17H31IN2O3S2 — CID 166807131
4-[1-[2-(1-iodoethylamino)ethyldisulfanyl]ethoxy]butyl N-(4-methylpent-2-ynyl)carbamate (PubChem CID 166807131) has the molecular formula C17H31IN2O3S2 and a molecular weight of 502.48 g/mol. Its IUPAC name is 4-[1-[2-(1-iodoethylamino)ethyldisulfanyl]ethoxy]butyl N-(4-methylpent-2-ynyl)carbamate.
| Compound Name | 4-[1-[2-(1-iodoethylamino)ethyldisulfanyl]ethoxy]butyl N-(4-methylpent-2-ynyl)carbamate |
|---|---|
| PubChem CID | 166807131 |
| Molecular Formula | C17H31IN2O3S2 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 4-[1-[2-(1-iodoethylamino)ethyldisulfanyl]ethoxy]butyl N-(4-methylpent-2-ynyl)carbamate |
| SMILES | CC(C)C#CCNC(=O)OCCCCOC(C)SSCCNC(C)I |
| InChI | InChI=1S/C17H31IN2O3S2/c1-14(2)8-7-9-20-17(21)23-12-6-5-11-22-16(4)25-24-13-10-19-15(3)18/h14-16,19H,5-6,9-13H2,1-4H3,(H,20,21) |
| InChIKey | NBZDZTAUKMGGDA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|