C18H35N3O2S2 — CID 155048814
1-[4-[[2-(butylamino)ethyldisulfanyl]methoxy]butyl]-3-(4-methylpent-2-ynyl)urea (PubChem CID 155048814) has the molecular formula C18H35N3O2S2 and a molecular weight of 389.63 g/mol. Its IUPAC name is 1-[4-[[2-(butylamino)ethyldisulfanyl]methoxy]butyl]-3-(4-methylpent-2-ynyl)urea.
| Compound Name | 1-[4-[[2-(butylamino)ethyldisulfanyl]methoxy]butyl]-3-(4-methylpent-2-ynyl)urea |
|---|---|
| PubChem CID | 155048814 |
| Molecular Formula | C18H35N3O2S2 |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-[4-[[2-(butylamino)ethyldisulfanyl]methoxy]butyl]-3-(4-methylpent-2-ynyl)urea |
| SMILES | CCCCNCCSSCOCCCCNC(=O)NCC#CC(C)C |
| InChI | InChI=1S/C18H35N3O2S2/c1-4-5-10-19-13-15-24-25-16-23-14-7-6-11-20-18(22)21-12-8-9-17(2)3/h17,19H,4-7,10-16H2,1-3H3,(H2,20,21,22) |
| InChIKey | KHASKKBRZCCDQK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|