C19H36N2O3S2 — CID 153366133
1-(2-pent-2-ynoxyethylamino)-6-[[2-(propan-2-ylamino)ethyldisulfanyl]methoxy]hexan-2-one (PubChem CID 153366133) has the molecular formula C19H36N2O3S2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 1-(2-pent-2-ynoxyethylamino)-6-[[2-(propan-2-ylamino)ethyldisulfanyl]methoxy]hexan-2-one.
| Compound Name | 1-(2-pent-2-ynoxyethylamino)-6-[[2-(propan-2-ylamino)ethyldisulfanyl]methoxy]hexan-2-one |
|---|---|
| PubChem CID | 153366133 |
| Molecular Formula | C19H36N2O3S2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1-(2-pent-2-ynoxyethylamino)-6-[[2-(propan-2-ylamino)ethyldisulfanyl]methoxy]hexan-2-one |
| SMILES | CCC#CCOCCNCC(=O)CCCCOCSSCCNC(C)C |
| InChI | InChI=1S/C19H36N2O3S2/c1-4-5-7-12-23-14-10-20-16-19(22)9-6-8-13-24-17-26-25-15-11-21-18(2)3/h18,20-21H,4,6,8-17H2,1-3H3 |
| InChIKey | PGIDHFFLOKVYOD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|