C32H62N2O6S2 — CID 159457900
2-methyl-9-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]nonane-3,6-dione;2-methyl-9-[2-(propan-2-ylamino)ethyldisulfanyl]nonane-3,6-dione (PubChem CID 159457900) has the molecular formula C32H62N2O6S2 and a molecular weight of 634.99 g/mol. Its IUPAC name is 2-methyl-9-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]nonane-3,6-dione;2-methyl-9-[2-(propan-2-ylamino)ethyldisulfanyl]nonane-3,6-dione.
| Compound Name | 2-methyl-9-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]nonane-3,6-dione;2-methyl-9-[2-(propan-2-ylamino)ethyldisulfanyl]nonane-3,6-dione |
|---|---|
| PubChem CID | 159457900 |
| Molecular Formula | C32H62N2O6S2 |
| Molecular Weight | 634.99 g/mol |
| Exact Mass | 634.40 |
| IUPAC Name | 2-methyl-9-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]nonane-3,6-dione;2-methyl-9-[2-(propan-2-ylamino)ethyldisulfanyl]nonane-3,6-dione |
| SMILES | CC(C)NCCOCCOCCCC(=O)CCC(=O)C(C)C.CC(C)NCCSSCCCC(=O)CCC(=O)C(C)C |
| InChI | InChI=1S/C17H33NO4.C15H29NO2S2/c1-14(2)17(20)8-7-16(19)6-5-10-21-12-13-22-11-9-18-15(3)4;1-12(2)15(18)8-7-14(17)6-5-10-19-20-11-9-16-13(3)4/h14-15,18H,5-13H2,1-4H3;12-13,16H,5-11H2,1-4H3 |
| InChIKey | LUFGHGIEABERFJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.99 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|