C14H28N2O2S2 — CID 146499201
5-[[2-(propan-2-ylamino)ethyldisulfanyl]methoxy]-N-prop-2-enylpentanamide (PubChem CID 146499201) has the molecular formula C14H28N2O2S2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 5-[[2-(propan-2-ylamino)ethyldisulfanyl]methoxy]-N-prop-2-enylpentanamide.
| Compound Name | 5-[[2-(propan-2-ylamino)ethyldisulfanyl]methoxy]-N-prop-2-enylpentanamide |
|---|---|
| PubChem CID | 146499201 |
| Molecular Formula | C14H28N2O2S2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 5-[[2-(propan-2-ylamino)ethyldisulfanyl]methoxy]-N-prop-2-enylpentanamide |
| SMILES | C=CCNC(=O)CCCCOCSSCCNC(C)C |
| InChI | InChI=1S/C14H28N2O2S2/c1-4-8-16-14(17)7-5-6-10-18-12-20-19-11-9-15-13(2)3/h4,13,15H,1,5-12H2,2-3H3,(H,16,17) |
| InChIKey | ONMKMWIGDIWFIR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|