C15H28BN2O3S2 — CID 153336610
CID 153336610 (PubChem CID 153336610) has the molecular formula C15H28BN2O3S2 and a molecular weight of 359.35 g/mol.
| Compound Name | CID 153336610 |
|---|---|
| PubChem CID | 153336610 |
| Molecular Formula | C15H28BN2O3S2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | — |
| SMILES | C[B]C#CCOCCNC(=O)CCCCOCSSCCNC |
| InChI | InChI=1S/C15H28BN2O3S2/c1-16-7-5-11-20-12-8-18-15(19)6-3-4-10-21-14-23-22-13-9-17-2/h17H,3-4,6,8-14H2,1-2H3,(H,18,19) |
| InChIKey | OVJRVDOMMRMVJW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|