C16H31N3OS2 — CID 166830903
4-methyl-N-[3-[2-[1-[2-(methylamino)ethyldisulfanyl]ethylamino]ethoxy]prop-1-en-2-yl]pent-2-yn-1-amine (PubChem CID 166830903) has the molecular formula C16H31N3OS2 and a molecular weight of 345.58 g/mol. Its IUPAC name is 4-methyl-N-[3-[2-[1-[2-(methylamino)ethyldisulfanyl]ethylamino]ethoxy]prop-1-en-2-yl]pent-2-yn-1-amine.
| Compound Name | 4-methyl-N-[3-[2-[1-[2-(methylamino)ethyldisulfanyl]ethylamino]ethoxy]prop-1-en-2-yl]pent-2-yn-1-amine |
|---|---|
| PubChem CID | 166830903 |
| Molecular Formula | C16H31N3OS2 |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-methyl-N-[3-[2-[1-[2-(methylamino)ethyldisulfanyl]ethylamino]ethoxy]prop-1-en-2-yl]pent-2-yn-1-amine |
| SMILES | C=C(COCCNC(C)SSCCNC)NCC#CC(C)C |
| InChI | InChI=1S/C16H31N3OS2/c1-14(2)7-6-8-18-15(3)13-20-11-9-19-16(4)22-21-12-10-17-5/h14,16-19H,3,8-13H2,1-2,4-5H3 |
| InChIKey | DNBHNXVGKBUXFO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|