C17H35NO4 — CID 168959349
ethane;N-methyl-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethoxy]ethoxy]ethoxy]ethanamine (PubChem CID 168959349) has the molecular formula C17H35NO4 and a molecular weight of 317.47 g/mol. Its IUPAC name is ethane;N-methyl-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | ethane;N-methyl-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 168959349 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | ethane;N-methyl-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethoxy]ethoxy]ethoxy]ethanamine |
| SMILES | CC.CNCCOCCOCCOCCOCC#CC(C)C |
| InChI | InChI=1S/C15H29NO4.C2H6/c1-15(2)5-4-7-17-9-11-19-13-14-20-12-10-18-8-6-16-3;1-2/h15-16H,6-14H2,1-3H3;1-2H3 |
| InChIKey | AIIMBDHOAVLEAA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|