C16H27N2O5S- — CID 170709353
4-[2-[2-(4-methylpent-2-ynoxy)ethoxy]ethylcarbamoyl]piperidine-1-sulfinate (PubChem CID 170709353) has the molecular formula C16H27N2O5S- and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[2-[2-(4-methylpent-2-ynoxy)ethoxy]ethylcarbamoyl]piperidine-1-sulfinate.
| Compound Name | 4-[2-[2-(4-methylpent-2-ynoxy)ethoxy]ethylcarbamoyl]piperidine-1-sulfinate |
|---|---|
| PubChem CID | 170709353 |
| Molecular Formula | C16H27N2O5S- |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-[2-[2-(4-methylpent-2-ynoxy)ethoxy]ethylcarbamoyl]piperidine-1-sulfinate |
| SMILES | CC(C)C#CCOCCOCCNC(=O)C1CCN(S(=O)[O-])CC1 |
| InChI | InChI=1S/C16H28N2O5S/c1-14(2)4-3-10-22-12-13-23-11-7-17-16(19)15-5-8-18(9-6-15)24(20)21/h14-15H,5-13H2,1-2H3,(H,17,19)(H,20,21)/p-1 |
| InChIKey | YODHBWCFCGTWAJ-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|