C25H44N2O5 — CID 166497237
4-N-[2-(4,4-dimethylpent-2-ynoxy)ethyl]-1-N-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]cyclohexane-1,4-dicarboxamide (PubChem CID 166497237) has the molecular formula C25H44N2O5 and a molecular weight of 452.64 g/mol. Its IUPAC name is 4-N-[2-(4,4-dimethylpent-2-ynoxy)ethyl]-1-N-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-[2-(4,4-dimethylpent-2-ynoxy)ethyl]-1-N-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 166497237 |
| Molecular Formula | C25H44N2O5 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | 4-N-[2-(4,4-dimethylpent-2-ynoxy)ethyl]-1-N-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]cyclohexane-1,4-dicarboxamide |
| SMILES | CC(C)(C)C#CCOCCNC(=O)C1CCC(C(=O)NCCOCCOC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H44N2O5/c1-24(2,3)12-7-15-30-16-13-26-22(28)20-8-10-21(11-9-20)23(29)27-14-17-31-18-19-32-25(4,5)6/h20-21H,8-11,13-19H2,1-6H3,(H,26,28)(H,27,29) |
| InChIKey | ZBOLYHDFZUEEFL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|