C23H42N2O4 — CID 166497234
4-N-(4,4-dimethylpent-2-enyl)-1-N-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]cyclohexane-1,4-dicarboxamide (PubChem CID 166497234) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is 4-N-(4,4-dimethylpent-2-enyl)-1-N-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(4,4-dimethylpent-2-enyl)-1-N-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 166497234 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | 4-N-(4,4-dimethylpent-2-enyl)-1-N-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]cyclohexane-1,4-dicarboxamide |
| SMILES | CC(C)(C)C=CCNC(=O)C1CCC(C(=O)NCCOCCOC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H42N2O4/c1-22(2,3)12-7-13-24-20(26)18-8-10-19(11-9-18)21(27)25-14-15-28-16-17-29-23(4,5)6/h7,12,18-19H,8-11,13-17H2,1-6H3,(H,24,26)(H,25,27) |
| InChIKey | KJXGGAXUNHIPLE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|