C13H21NO — CID 68854459
N-nona-2,6-dienylcyclopropanecarboxamide (PubChem CID 68854459) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-nona-2,6-dienylcyclopropanecarboxamide.
| Compound Name | N-nona-2,6-dienylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 68854459 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-nona-2,6-dienylcyclopropanecarboxamide |
| SMILES | CCC=CCCC=CCNC(=O)C1CC1 |
| InChI | InChI=1S/C13H21NO/c1-2-3-4-5-6-7-8-11-14-13(15)12-9-10-12/h3-4,7-8,12H,2,5-6,9-11H2,1H3,(H,14,15) |
| InChIKey | NKVLGNUCZRZLCZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|