C12H20FNO2 — CID 58895238
2-fluoroethyl N-[(2E,6Z)-nona-2,6-dienyl]carbamate (PubChem CID 58895238) has the molecular formula C12H20FNO2 and a molecular weight of 229.29 g/mol. Its IUPAC name is 2-fluoroethyl N-[(2E,6Z)-nona-2,6-dienyl]carbamate.
| Compound Name | 2-fluoroethyl N-[(2E,6Z)-nona-2,6-dienyl]carbamate |
|---|---|
| PubChem CID | 58895238 |
| Molecular Formula | C12H20FNO2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-fluoroethyl N-[(2E,6Z)-nona-2,6-dienyl]carbamate |
| SMILES | CC/C=C\CC/C=C/CNC(=O)OCCF |
| InChI | InChI=1S/C12H20FNO2/c1-2-3-4-5-6-7-8-10-14-12(15)16-11-9-13/h3-4,7-8H,2,5-6,9-11H2,1H3,(H,14,15)/b4-3-,8-7+ |
| InChIKey | FRDJLUZPDYIFIN-ODYTWBPASA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|