C16H29NO3 — CID 58895290
(3-methoxy-3-methylbutyl) N-[(2E,6Z)-nona-2,6-dienyl]carbamate (PubChem CID 58895290) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is (3-methoxy-3-methylbutyl) N-[(2E,6Z)-nona-2,6-dienyl]carbamate.
| Compound Name | (3-methoxy-3-methylbutyl) N-[(2E,6Z)-nona-2,6-dienyl]carbamate |
|---|---|
| PubChem CID | 58895290 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (3-methoxy-3-methylbutyl) N-[(2E,6Z)-nona-2,6-dienyl]carbamate |
| SMILES | CC/C=C\CC/C=C/CNC(=O)OCCC(C)(C)OC |
| InChI | InChI=1S/C16H29NO3/c1-5-6-7-8-9-10-11-13-17-15(18)20-14-12-16(2,3)19-4/h6-7,10-11H,5,8-9,12-14H2,1-4H3,(H,17,18)/b7-6-,11-10+ |
| InChIKey | XPAYQPZOCCJCSP-JFEAUALZSA-N |
| XLogP | 3.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|