C14H22N2O3 — CID 106666335
(3-methoxy-3-methylbutyl) N-[4-(aminomethyl)phenyl]carbamate (PubChem CID 106666335) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (3-methoxy-3-methylbutyl) N-[4-(aminomethyl)phenyl]carbamate.
| Compound Name | (3-methoxy-3-methylbutyl) N-[4-(aminomethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 106666335 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (3-methoxy-3-methylbutyl) N-[4-(aminomethyl)phenyl]carbamate |
| SMILES | COC(C)(C)CCOC(=O)Nc1ccc(CN)cc1 |
| InChI | InChI=1S/C14H22N2O3/c1-14(2,18-3)8-9-19-13(17)16-12-6-4-11(10-15)5-7-12/h4-7H,8-10,15H2,1-3H3,(H,16,17) |
| InChIKey | CBBXOXNZBKWMBC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |