C12H18N2O2 — CID 132507033
tert-butyl N-[4-(aminomethyl)-2,6-dideuteriophenyl]carbamate (PubChem CID 132507033) has the molecular formula C12H18N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is tert-butyl N-[4-(aminomethyl)-2,6-dideuteriophenyl]carbamate.
| Compound Name | tert-butyl N-[4-(aminomethyl)-2,6-dideuteriophenyl]carbamate |
|---|---|
| PubChem CID | 132507033 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | tert-butyl N-[4-(aminomethyl)-2,6-dideuteriophenyl]carbamate |
| SMILES | [2H]c1cc(CN)cc([2H])c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H18N2O2/c1-12(2,3)16-11(15)14-10-6-4-9(8-13)5-7-10/h4-7H,8,13H2,1-3H3,(H,14,15)/i6D,7D |
| InChIKey | URXUHALBOWYXJZ-QFIQSOQBSA-N |
| XLogP | 2.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |