About 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate
2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate (PubChem CID 165344355) has the molecular formula C8H10F2N2O6
and a molecular weight of 268.17 g/mol. Its IUPAC name is 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate.
Molecular Properties
| Compound Name | 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate |
| PubChem CID | 165344355 |
| Molecular Formula | C8H10F2N2O6 |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate |
| SMILES | O=C(NC(=O)C(=O)NC(=O)OCCF)OCCF |
| InChI | InChI=1S/C8H10F2N2O6/c9-1-3-17-7(15)11-5(13)6(14)12-8(16)18-4-2-10/h1-4H2,(H,11,13,15)(H,12,14,16) |
| InChIKey | WMQFEICYRAACHH-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate?
The IUPAC name of 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate (CID 165344355) is 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate.
What is the SMILES notation for 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate?
The canonical SMILES for 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate is O=C(NC(=O)C(=O)NC(=O)OCCF)OCCF.
What is the InChIKey of 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate?
The InChIKey is WMQFEICYRAACHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O6/c9-1-3-17-7(15)11-5(13)6(14)12-8(16)18-4-2-10/h1-4H2,(H,11,13,15)(H,12,14,16).
What are the key properties of 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate?
2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate has a molecular weight of 268.17 g/mol, XLogP of -0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl N-[2-(2-fluoroethoxycarbonylamino)-2-oxoacetyl]carbamate is sourced from PubChem (CID 165344355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).