C11H14FNO4 — CID 13298348
2-fluoroethyl N-(3,5-dimethoxyphenyl)carbamate (PubChem CID 13298348) has the molecular formula C11H14FNO4 and a molecular weight of 243.23 g/mol. Its IUPAC name is 2-fluoroethyl N-(3,5-dimethoxyphenyl)carbamate.
| Compound Name | 2-fluoroethyl N-(3,5-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 13298348 |
| Molecular Formula | C11H14FNO4 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-fluoroethyl N-(3,5-dimethoxyphenyl)carbamate |
| SMILES | COc1cc(NC(=O)OCCF)cc(OC)c1 |
| InChI | InChI=1S/C11H14FNO4/c1-15-9-5-8(6-10(7-9)16-2)13-11(14)17-4-3-12/h5-7H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | AQWJPLLABSQUGS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |