C11H23NO2 — CID 164564557
ethane;N-ethyl-4-hydroxycyclohexane-1-carboxamide (PubChem CID 164564557) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;N-ethyl-4-hydroxycyclohexane-1-carboxamide.
| Compound Name | ethane;N-ethyl-4-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 164564557 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | ethane;N-ethyl-4-hydroxycyclohexane-1-carboxamide |
| SMILES | CC.CCNC(=O)C1CCC(O)CC1 |
| InChI | InChI=1S/C9H17NO2.C2H6/c1-2-10-9(12)7-3-5-8(11)6-4-7;1-2/h7-8,11H,2-6H2,1H3,(H,10,12);1-2H3 |
| InChIKey | UYHNWFGVUDVFBU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |