C16H35NO2 — CID 161174524
4,4-dimethylpentan-1-ol;N-ethylcyclopropanecarboxamide;propane (PubChem CID 161174524) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is 4,4-dimethylpentan-1-ol;N-ethylcyclopropanecarboxamide;propane.
| Compound Name | 4,4-dimethylpentan-1-ol;N-ethylcyclopropanecarboxamide;propane |
|---|---|
| PubChem CID | 161174524 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | 4,4-dimethylpentan-1-ol;N-ethylcyclopropanecarboxamide;propane |
| SMILES | CC(C)(C)CCCO.CCC.CCNC(=O)C1CC1 |
| InChI | InChI=1S/C7H16O.C6H11NO.C3H8/c1-7(2,3)5-4-6-8;1-2-7-6(8)5-3-4-5;1-3-2/h8H,4-6H2,1-3H3;5H,2-4H2,1H3,(H,7,8);3H2,1-2H3 |
| InChIKey | URPXFYYCGMETPZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |