C11H17F2NO — CID 156872223
N-ethyl-2,2-difluorospiro[2.5]octane-6-carboxamide (PubChem CID 156872223) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is N-ethyl-2,2-difluorospiro[2.5]octane-6-carboxamide.
| Compound Name | N-ethyl-2,2-difluorospiro[2.5]octane-6-carboxamide |
|---|---|
| PubChem CID | 156872223 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N-ethyl-2,2-difluorospiro[2.5]octane-6-carboxamide |
| SMILES | CCNC(=O)C1CCC2(CC1)CC2(F)F |
| InChI | InChI=1S/C11H17F2NO/c1-2-14-9(15)8-3-5-10(6-4-8)7-11(10,12)13/h8H,2-7H2,1H3,(H,14,15) |
| InChIKey | OVEZMUNDYKAFMO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |