About N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride
N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride (PubChem CID 91660382) has the molecular formula C15H29ClN2O
and a molecular weight of 288.86 g/mol. Its IUPAC name is N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride |
| PubChem CID | 91660382 |
| Molecular Formula | C15H29ClN2O |
| Molecular Weight | 288.86 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride |
| SMILES | CC1(CNC(=O)C2CCCCCC2)CCNCC1.Cl |
| InChI | InChI=1S/C15H28N2O.ClH/c1-15(8-10-16-11-9-15)12-17-14(18)13-6-4-2-3-5-7-13;/h13,16H,2-12H2,1H3,(H,17,18);1H |
| InChIKey | RRRMJQKVQRGWKW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.86 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride?
The IUPAC name of N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride (CID 91660382) is N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride.
What is the SMILES notation for N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride?
The canonical SMILES for N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride is CC1(CNC(=O)C2CCCCCC2)CCNCC1.Cl.
What is the InChIKey of N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride?
The InChIKey is RRRMJQKVQRGWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O.ClH/c1-15(8-10-16-11-9-15)12-17-14(18)13-6-4-2-3-5-7-13;/h13,16H,2-12H2,1H3,(H,17,18);1H.
What are the key properties of N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride?
N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride has a molecular weight of 288.86 g/mol, XLogP of 2.88, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methylpiperidin-4-yl)methyl]cycloheptanecarboxamide;hydrochloride is sourced from PubChem (CID 91660382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).