C18H35NO2 — CID 90789963
ethane;formaldehyde;N-[(1-methylcyclohexyl)methyl]cyclohexanecarboxamide (PubChem CID 90789963) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is ethane;formaldehyde;N-[(1-methylcyclohexyl)methyl]cyclohexanecarboxamide.
| Compound Name | ethane;formaldehyde;N-[(1-methylcyclohexyl)methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 90789963 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | ethane;formaldehyde;N-[(1-methylcyclohexyl)methyl]cyclohexanecarboxamide |
| SMILES | C=O.CC.CC1(CNC(=O)C2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C15H27NO.C2H6.CH2O/c1-15(10-6-3-7-11-15)12-16-14(17)13-8-4-2-5-9-13;2*1-2/h13H,2-12H2,1H3,(H,16,17);1-2H3;1H2 |
| InChIKey | MSLQOCABLAZKOB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |