C15H27NO2 — CID 65114198
N-[(1-hydroxycyclohexyl)methyl]cycloheptanecarboxamide (PubChem CID 65114198) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is N-[(1-hydroxycyclohexyl)methyl]cycloheptanecarboxamide.
| Compound Name | N-[(1-hydroxycyclohexyl)methyl]cycloheptanecarboxamide |
|---|---|
| PubChem CID | 65114198 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | N-[(1-hydroxycyclohexyl)methyl]cycloheptanecarboxamide |
| SMILES | O=C(NCC1(O)CCCCC1)C1CCCCCC1 |
| InChI | InChI=1S/C15H27NO2/c17-14(13-8-4-1-2-5-9-13)16-12-15(18)10-6-3-7-11-15/h13,18H,1-12H2,(H,16,17) |
| InChIKey | KPMUYFIGTMOGKT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |