C12H15NO2 — CID 174338742
N-[(2Z,4E)-4-methoxyhepta-2,4-dien-6-ynyl]cyclopropanecarboxamide (PubChem CID 174338742) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-[(2Z,4E)-4-methoxyhepta-2,4-dien-6-ynyl]cyclopropanecarboxamide.
| Compound Name | N-[(2Z,4E)-4-methoxyhepta-2,4-dien-6-ynyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 174338742 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-[(2Z,4E)-4-methoxyhepta-2,4-dien-6-ynyl]cyclopropanecarboxamide |
| SMILES | C#C/C=C(\C=C/CNC(=O)C1CC1)OC |
| InChI | InChI=1S/C12H15NO2/c1-3-5-11(15-2)6-4-9-13-12(14)10-7-8-10/h1,4-6,10H,7-9H2,2H3,(H,13,14)/b6-4-,11-5+ |
| InChIKey | OEWSPNPEFIATFO-NQTKGXIKSA-N |
| XLogP | 1.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|