C15H20N4O3 — CID 146099695
methyl (E)-4-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl)amino]but-2-enoate (PubChem CID 146099695) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl (E)-4-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl)amino]but-2-enoate.
| Compound Name | methyl (E)-4-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 146099695 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl (E)-4-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl)amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C1CCc2nnc(C3CC3)n2C1 |
| InChI | InChI=1S/C15H20N4O3/c1-22-13(20)3-2-8-16-15(21)11-6-7-12-17-18-14(10-4-5-10)19(12)9-11/h2-3,10-11H,4-9H2,1H3,(H,16,21)/b3-2+ |
| InChIKey | SHNZWSCPZJJCLT-NSCUHMNNSA-N |
| XLogP | 0.56 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|