C19H21N3O3 — CID 154794746
methyl (E)-4-[(3-phenyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carbonyl)amino]but-2-enoate (PubChem CID 154794746) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is methyl (E)-4-[(3-phenyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carbonyl)amino]but-2-enoate.
| Compound Name | methyl (E)-4-[(3-phenyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carbonyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 154794746 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | methyl (E)-4-[(3-phenyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carbonyl)amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C1CCn2c(cnc2-c2ccccc2)C1 |
| InChI | InChI=1S/C19H21N3O3/c1-25-17(23)8-5-10-20-19(24)15-9-11-22-16(12-15)13-21-18(22)14-6-3-2-4-7-14/h2-8,13,15H,9-12H2,1H3,(H,20,24)/b8-5+ |
| InChIKey | QHOIZEAAXWANEM-VMPITWQZSA-N |
| XLogP | 1.96 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|