C23H26N4O5 — CID 136718577
(6R)-3-(4-hydroxyphenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 136718577) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is (6R)-3-(4-hydroxyphenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | (6R)-3-(4-hydroxyphenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 136718577 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (6R)-3-(4-hydroxyphenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)[C@@H]1CCc2nnc(-c3ccc(O)cc3)n2C1 |
| InChI | InChI=1S/C23H26N4O5/c1-30-18-11-20(32-3)19(31-2)10-16(18)12-24-23(29)15-6-9-21-25-26-22(27(21)13-15)14-4-7-17(28)8-5-14/h4-5,7-8,10-11,15,28H,6,9,12-13H2,1-3H3,(H,24,29)/t15-/m1/s1 |
| InChIKey | KYASXBRYNJISTQ-OAHLLOKOSA-N |
| XLogP | 2.56 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |