C37H51N3O12S2 — CID 129130928
4-[[[4-[2-[2-[2-(9,9a-dihydro-4aH-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylcarbamoyloxy]-2-methylbutan-2-yl]disulfanyl]methoxy]butyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 129130928) has the molecular formula C37H51N3O12S2 and a molecular weight of 793.96 g/mol. Its IUPAC name is 4-[[[4-[2-[2-[2-(9,9a-dihydro-4aH-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylcarbamoyloxy]-2-methylbutan-2-yl]disulfanyl]methoxy]butyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | 4-[[[4-[2-[2-[2-(9,9a-dihydro-4aH-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylcarbamoyloxy]-2-methylbutan-2-yl]disulfanyl]methoxy]butyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 129130928 |
| Molecular Formula | C37H51N3O12S2 |
| Molecular Weight | 793.96 g/mol |
| Exact Mass | 793.29 |
| IUPAC Name | 4-[[[4-[2-[2-[2-(9,9a-dihydro-4aH-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylcarbamoyloxy]-2-methylbutan-2-yl]disulfanyl]methoxy]butyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | CC(C)(CCOC(=O)NCCOCCOCCNC(=O)OCC1c2ccccc2C2C=CC=CC21)SSCOCCCCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C37H51N3O12S2/c1-37(2,54-53-26-48-18-7-8-19-50-36(45)52-40-32(41)13-14-33(40)42)15-20-49-34(43)38-16-21-46-23-24-47-22-17-39-35(44)51-25-31-29-11-5-3-9-27(29)28-10-4-6-12-30(28)31/h3-6,9-12,27,29,31H,7-8,13-26H2,1-2H3,(H,38,43)(H,39,44) |
| InChIKey | GPTGBKOALNGHIV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 177.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.96 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|