C27H42N2O10 — CID 154992920
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[(1R,4Z,8S,9S)-4-methyl-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 154992920) has the molecular formula C27H42N2O10 and a molecular weight of 554.64 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[(1R,4Z,8S,9S)-4-methyl-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[(1R,4Z,8S,9S)-4-methyl-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 154992920 |
| Molecular Formula | C27H42N2O10 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[(1R,4Z,8S,9S)-4-methyl-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | C/C1=C/CC[C@H]2[C@@H](CC1)[C@H]2COC(=O)NCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C27H42N2O10/c1-20-3-2-4-21-22(6-5-20)23(21)19-38-27(33)28-10-12-35-14-16-37-18-17-36-15-13-34-11-9-26(32)39-29-24(30)7-8-25(29)31/h3,21-23H,2,4-19H2,1H3,(H,28,33)/b20-3-/t21-,22+,23-/m0/s1 |
| InChIKey | IDLGZHBYMCVSID-KRILWEMHSA-N |
| XLogP | 2.16 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|