C15H32N6O4 — CID 101236265
tert-butyl N-[2-[2-[4-(diaminomethylideneamino)butylcarbamoylamino]ethoxy]ethyl]carbamate (PubChem CID 101236265) has the molecular formula C15H32N6O4 and a molecular weight of 360.46 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[4-(diaminomethylideneamino)butylcarbamoylamino]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[4-(diaminomethylideneamino)butylcarbamoylamino]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 101236265 |
| Molecular Formula | C15H32N6O4 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | tert-butyl N-[2-[2-[4-(diaminomethylideneamino)butylcarbamoylamino]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCNC(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C15H32N6O4/c1-15(2,3)25-14(23)21-9-11-24-10-8-20-13(22)19-7-5-4-6-18-12(16)17/h4-11H2,1-3H3,(H,21,23)(H4,16,17,18)(H2,19,20,22) |
| InChIKey | QUUWEXKSTDQDSD-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|