C27H43N3O7S2 — CID 167289953
4-[[[4-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]phenyl]disulfanyl]methoxy]butyl N-but-2-ynylcarbamate (PubChem CID 167289953) has the molecular formula C27H43N3O7S2 and a molecular weight of 585.79 g/mol. Its IUPAC name is 4-[[[4-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]phenyl]disulfanyl]methoxy]butyl N-but-2-ynylcarbamate.
| Compound Name | 4-[[[4-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]phenyl]disulfanyl]methoxy]butyl N-but-2-ynylcarbamate |
|---|---|
| PubChem CID | 167289953 |
| Molecular Formula | C27H43N3O7S2 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 4-[[[4-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]phenyl]disulfanyl]methoxy]butyl N-but-2-ynylcarbamate |
| SMILES | CC#CCNC(=O)OCCCCOCSSc1ccc(CC(=O)NCCOCCOCCOCCNC)cc1 |
| InChI | InChI=1S/C27H43N3O7S2/c1-3-4-11-30-27(32)37-15-6-5-14-36-23-38-39-25-9-7-24(8-10-25)22-26(31)29-13-17-34-19-21-35-20-18-33-16-12-28-2/h7-10,28H,5-6,11-23H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | JTMYPQAMACYQHN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|