C27H44N4O6S2 — CID 166842408
2-[4-[4-(but-2-ynylcarbamoylamino)butoxymethyldisulfanyl]phenyl]-N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 166842408) has the molecular formula C27H44N4O6S2 and a molecular weight of 584.81 g/mol. Its IUPAC name is 2-[4-[4-(but-2-ynylcarbamoylamino)butoxymethyldisulfanyl]phenyl]-N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-[4-[4-(but-2-ynylcarbamoylamino)butoxymethyldisulfanyl]phenyl]-N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 166842408 |
| Molecular Formula | C27H44N4O6S2 |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 2-[4-[4-(but-2-ynylcarbamoylamino)butoxymethyldisulfanyl]phenyl]-N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CC#CCNC(=O)NCCCCOCSSc1ccc(CC(=O)NCCOCCOCCOCCNC)cc1 |
| InChI | InChI=1S/C27H44N4O6S2/c1-3-4-11-30-27(33)31-12-5-6-15-37-23-38-39-25-9-7-24(8-10-25)22-26(32)29-14-17-35-19-21-36-20-18-34-16-13-28-2/h7-10,28H,5-6,11-23H2,1-2H3,(H,29,32)(H2,30,31,33) |
| InChIKey | MARRVUPZKMIHAY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|