C27H41N5O6 — CID 59758240
N'-[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]-N-[2-[3-(6-oxohexylcarbamoylamino)propoxy]ethyl]propanediamide (PubChem CID 59758240) has the molecular formula C27H41N5O6 and a molecular weight of 531.65 g/mol. Its IUPAC name is N'-[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]-N-[2-[3-(6-oxohexylcarbamoylamino)propoxy]ethyl]propanediamide.
| Compound Name | N'-[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]-N-[2-[3-(6-oxohexylcarbamoylamino)propoxy]ethyl]propanediamide |
|---|---|
| PubChem CID | 59758240 |
| Molecular Formula | C27H41N5O6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | N'-[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]-N-[2-[3-(6-oxohexylcarbamoylamino)propoxy]ethyl]propanediamide |
| SMILES | CN/C(C)=C\C(=O)Cc1ccc(NC(=O)CC(=O)NCCOCCCNC(=O)NCCCCCC=O)cc1 |
| InChI | InChI=1S/C27H41N5O6/c1-21(28-2)18-24(34)19-22-8-10-23(11-9-22)32-26(36)20-25(35)29-14-17-38-16-7-13-31-27(37)30-12-5-3-4-6-15-33/h8-11,15,18,28H,3-7,12-14,16-17,19-20H2,1-2H3,(H,29,35)(H,32,36)(H2,30,31,37)/b21-18- |
| InChIKey | ZTDHDEBZXQQUBP-UZYVYHOESA-N |
| XLogP | 1.83 |
| TPSA | 154.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|