C22H30N4O5Rb2 — CID 58705342
2-[4-(methylamino)-4-oxobutoxy]ethyl-[3-[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]azanidyl-3-oxopropanoyl]azanide;bis(rubidium(1+)) (PubChem CID 58705342) has the molecular formula C22H30N4O5Rb2 and a molecular weight of 601.44 g/mol. Its IUPAC name is 2-[4-(methylamino)-4-oxobutoxy]ethyl-[3-[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]azanidyl-3-oxopropanoyl]azanide;bis(rubidium(1+)).
| Compound Name | 2-[4-(methylamino)-4-oxobutoxy]ethyl-[3-[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]azanidyl-3-oxopropanoyl]azanide;bis(rubidium(1+)) |
|---|---|
| PubChem CID | 58705342 |
| Molecular Formula | C22H30N4O5Rb2 |
| Molecular Weight | 601.44 g/mol |
| Exact Mass | 600.05 |
| IUPAC Name | 2-[4-(methylamino)-4-oxobutoxy]ethyl-[3-[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]azanidyl-3-oxopropanoyl]azanide;bis(rubidium(1+)) |
| SMILES | CNC(=O)CCCOCC[N-]C(=O)CC(=O)[N-]c1ccc(CC(=O)/C=C(/C)NC)cc1.[Rb+].[Rb+] |
| InChI | InChI=1S/C22H32N4O5.2Rb/c1-16(23-2)13-19(27)14-17-6-8-18(9-7-17)26-22(30)15-21(29)25-10-12-31-11-4-5-20(28)24-3;;/h6-9,13H,4-5,10-12,14-15H2,1-3H3,(H4,23,24,25,26,27,28,29,30);;/q;2*+1/p-2 |
| InChIKey | IMSBBXGAHBMXQI-UHFFFAOYSA-L |
| XLogP | -3.71 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.44 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|