C19H28N4O5 — CID 59745848
3-[[2-[4-[[[2-(3-formamidopropoxy)acetyl]amino]methyl]phenyl]acetyl]amino]-N-methylpropanamide (PubChem CID 59745848) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[[2-[4-[[[2-(3-formamidopropoxy)acetyl]amino]methyl]phenyl]acetyl]amino]-N-methylpropanamide.
| Compound Name | 3-[[2-[4-[[[2-(3-formamidopropoxy)acetyl]amino]methyl]phenyl]acetyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 59745848 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-[[2-[4-[[[2-(3-formamidopropoxy)acetyl]amino]methyl]phenyl]acetyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNC(=O)Cc1ccc(CNC(=O)COCCCNC=O)cc1 |
| InChI | InChI=1S/C19H28N4O5/c1-20-17(25)7-9-22-18(26)11-15-3-5-16(6-4-15)12-23-19(27)13-28-10-2-8-21-14-24/h3-6,14H,2,7-13H2,1H3,(H,20,25)(H,21,24)(H,22,26)(H,23,27) |
| InChIKey | XRLNNAWHNWYGAB-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|