C25H34N2O5 — CID 167019595
2-(4-hydroxyphenyl)-N-[6-[3-[[2-(4-hydroxyphenyl)acetyl]amino]propoxy]hexyl]acetamide (PubChem CID 167019595) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-N-[6-[3-[[2-(4-hydroxyphenyl)acetyl]amino]propoxy]hexyl]acetamide.
| Compound Name | 2-(4-hydroxyphenyl)-N-[6-[3-[[2-(4-hydroxyphenyl)acetyl]amino]propoxy]hexyl]acetamide |
|---|---|
| PubChem CID | 167019595 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 2-(4-hydroxyphenyl)-N-[6-[3-[[2-(4-hydroxyphenyl)acetyl]amino]propoxy]hexyl]acetamide |
| SMILES | O=C(Cc1ccc(O)cc1)NCCCCCCOCCCNC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C25H34N2O5/c28-22-10-6-20(7-11-22)18-24(30)26-14-3-1-2-4-16-32-17-5-15-27-25(31)19-21-8-12-23(29)13-9-21/h6-13,28-29H,1-5,14-19H2,(H,26,30)(H,27,31) |
| InChIKey | SSTVPBJESZOLFO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|