C26H40N2O6 — CID 146530692
(4Z)-3-ethyl-6-hydroxy-N-[3-[2-[3-[[2-(4-hydroxyphenyl)acetyl]amino]propoxy]ethoxy]propyl]-3-methylhepta-4,6-dienamide (PubChem CID 146530692) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is (4Z)-3-ethyl-6-hydroxy-N-[3-[2-[3-[[2-(4-hydroxyphenyl)acetyl]amino]propoxy]ethoxy]propyl]-3-methylhepta-4,6-dienamide.
| Compound Name | (4Z)-3-ethyl-6-hydroxy-N-[3-[2-[3-[[2-(4-hydroxyphenyl)acetyl]amino]propoxy]ethoxy]propyl]-3-methylhepta-4,6-dienamide |
|---|---|
| PubChem CID | 146530692 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | (4Z)-3-ethyl-6-hydroxy-N-[3-[2-[3-[[2-(4-hydroxyphenyl)acetyl]amino]propoxy]ethoxy]propyl]-3-methylhepta-4,6-dienamide |
| SMILES | C=C(O)/C=C\C(C)(CC)CC(=O)NCCCOCCOCCCNC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C26H40N2O6/c1-4-26(3,12-11-21(2)29)20-25(32)28-14-6-16-34-18-17-33-15-5-13-27-24(31)19-22-7-9-23(30)10-8-22/h7-12,29-30H,2,4-6,13-20H2,1,3H3,(H,27,31)(H,28,32)/b12-11- |
| InChIKey | APFWVQYRVIKDBN-QXMHVHEDSA-N |
| XLogP | 3.41 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|