C28H43N3O5 — CID 160754812
4-[2-[methyl-[[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]methyl]amino]-2-oxoethoxy]-N-(5-methyl-6-oxoheptyl)butanamide (PubChem CID 160754812) has the molecular formula C28H43N3O5 and a molecular weight of 501.67 g/mol. Its IUPAC name is 4-[2-[methyl-[[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]methyl]amino]-2-oxoethoxy]-N-(5-methyl-6-oxoheptyl)butanamide.
| Compound Name | 4-[2-[methyl-[[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]methyl]amino]-2-oxoethoxy]-N-(5-methyl-6-oxoheptyl)butanamide |
|---|---|
| PubChem CID | 160754812 |
| Molecular Formula | C28H43N3O5 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | 4-[2-[methyl-[[4-[(Z)-4-(methylamino)-2-oxopent-3-enyl]phenyl]methyl]amino]-2-oxoethoxy]-N-(5-methyl-6-oxoheptyl)butanamide |
| SMILES | CN/C(C)=C\C(=O)Cc1ccc(CN(C)C(=O)COCCCC(=O)NCCCCC(C)C(C)=O)cc1 |
| InChI | InChI=1S/C28H43N3O5/c1-21(23(3)32)9-6-7-15-30-27(34)10-8-16-36-20-28(35)31(5)19-25-13-11-24(12-14-25)18-26(33)17-22(2)29-4/h11-14,17,21,29H,6-10,15-16,18-20H2,1-5H3,(H,30,34)/b22-17- |
| InChIKey | RXHFBYYRMKXKHS-XLNRJJMWSA-N |
| XLogP | 3.19 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|