C24H33N3O6 — CID 153099575
N-(5-methyl-6-oxoheptyl)-2-[2-[N-methyl-3-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]-2-oxoethoxy]acetamide (PubChem CID 153099575) has the molecular formula C24H33N3O6 and a molecular weight of 459.54 g/mol. Its IUPAC name is N-(5-methyl-6-oxoheptyl)-2-[2-[N-methyl-3-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]-2-oxoethoxy]acetamide.
| Compound Name | N-(5-methyl-6-oxoheptyl)-2-[2-[N-methyl-3-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]-2-oxoethoxy]acetamide |
|---|---|
| PubChem CID | 153099575 |
| Molecular Formula | C24H33N3O6 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | N-(5-methyl-6-oxoheptyl)-2-[2-[N-methyl-3-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]-2-oxoethoxy]acetamide |
| SMILES | CC(=O)C(C)CCCCNC(=O)COCC(=O)N(C)c1cccc(CC(=O)N2CCC2=O)c1 |
| InChI | InChI=1S/C24H33N3O6/c1-17(18(2)28)7-4-5-11-25-21(29)15-33-16-24(32)26(3)20-9-6-8-19(13-20)14-23(31)27-12-10-22(27)30/h6,8-9,13,17H,4-5,7,10-12,14-16H2,1-3H3,(H,25,29) |
| InChIKey | VQUGLDHNQHGANI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|