C27H38N4O8 — CID 59745825
3-[2-[[3-oxo-3-[4-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]propanoyl]amino]ethoxy]propyl N-(5-methyl-6-oxohexyl)carbamate (PubChem CID 59745825) has the molecular formula C27H38N4O8 and a molecular weight of 546.62 g/mol. Its IUPAC name is 3-[2-[[3-oxo-3-[4-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]propanoyl]amino]ethoxy]propyl N-(5-methyl-6-oxohexyl)carbamate.
| Compound Name | 3-[2-[[3-oxo-3-[4-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]propanoyl]amino]ethoxy]propyl N-(5-methyl-6-oxohexyl)carbamate |
|---|---|
| PubChem CID | 59745825 |
| Molecular Formula | C27H38N4O8 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 3-[2-[[3-oxo-3-[4-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]propanoyl]amino]ethoxy]propyl N-(5-methyl-6-oxohexyl)carbamate |
| SMILES | CC(C=O)CCCCNC(=O)OCCCOCCNC(=O)CC(=O)Nc1ccc(CC(=O)N2CCC2=O)cc1 |
| InChI | InChI=1S/C27H38N4O8/c1-20(19-32)5-2-3-11-29-27(37)39-15-4-14-38-16-12-28-23(33)18-24(34)30-22-8-6-21(7-9-22)17-26(36)31-13-10-25(31)35/h6-9,19-20H,2-5,10-18H2,1H3,(H,28,33)(H,29,37)(H,30,34) |
| InChIKey | PTVUDPBPZGIXCT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|