C25H35N2O7Rb — CID 59745864
[4-(2,4-dioxopentyl)phenyl]methyl-[2-[3-[(5-methyl-6-oxohexyl)carbamoyloxy]propoxy]acetyl]azanide;rubidium(1+) (PubChem CID 59745864) has the molecular formula C25H35N2O7Rb and a molecular weight of 561.03 g/mol. Its IUPAC name is [4-(2,4-dioxopentyl)phenyl]methyl-[2-[3-[(5-methyl-6-oxohexyl)carbamoyloxy]propoxy]acetyl]azanide;rubidium(1+).
| Compound Name | [4-(2,4-dioxopentyl)phenyl]methyl-[2-[3-[(5-methyl-6-oxohexyl)carbamoyloxy]propoxy]acetyl]azanide;rubidium(1+) |
|---|---|
| PubChem CID | 59745864 |
| Molecular Formula | C25H35N2O7Rb |
| Molecular Weight | 561.03 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | [4-(2,4-dioxopentyl)phenyl]methyl-[2-[3-[(5-methyl-6-oxohexyl)carbamoyloxy]propoxy]acetyl]azanide;rubidium(1+) |
| SMILES | CC(=O)CC(=O)Cc1ccc(C[N-]C(=O)COCCCOC(=O)NCCCCC(C)C=O)cc1.[Rb+] |
| InChI | InChI=1S/C25H36N2O7.Rb/c1-19(17-28)6-3-4-11-26-25(32)34-13-5-12-33-18-24(31)27-16-22-9-7-21(8-10-22)15-23(30)14-20(2)29;/h7-10,17,19H,3-6,11-16,18H2,1-2H3,(H2,26,27,31,32);/q;+1/p-1 |
| InChIKey | UXDWRPTTXXNQPQ-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.03 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|