C24H33N2O5Rb — CID 59745870
[2-(3-butanoyloxypropoxy)acetyl]-[[4-[2-(methylamino)cyclohexene-1-carbonyl]phenyl]methyl]azanide;rubidium(1+) (PubChem CID 59745870) has the molecular formula C24H33N2O5Rb and a molecular weight of 515.01 g/mol. Its IUPAC name is [2-(3-butanoyloxypropoxy)acetyl]-[[4-[2-(methylamino)cyclohexene-1-carbonyl]phenyl]methyl]azanide;rubidium(1+).
| Compound Name | [2-(3-butanoyloxypropoxy)acetyl]-[[4-[2-(methylamino)cyclohexene-1-carbonyl]phenyl]methyl]azanide;rubidium(1+) |
|---|---|
| PubChem CID | 59745870 |
| Molecular Formula | C24H33N2O5Rb |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | [2-(3-butanoyloxypropoxy)acetyl]-[[4-[2-(methylamino)cyclohexene-1-carbonyl]phenyl]methyl]azanide;rubidium(1+) |
| SMILES | CCCC(=O)OCCCOCC(=O)[N-]Cc1ccc(C(=O)C2=C(NC)CCCC2)cc1.[Rb+] |
| InChI | InChI=1S/C24H34N2O5.Rb/c1-3-7-23(28)31-15-6-14-30-17-22(27)26-16-18-10-12-19(13-11-18)24(29)20-8-4-5-9-21(20)25-2;/h10-13H,3-9,14-17H2,1-2H3,(H2,25,26,27,29);/q;+1/p-1 |
| InChIKey | XPAWYKACOXTPGA-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|