C23H34N2O5 — CID 159894736
methane;3-[2-[methyl-[[4-[2-(methylamino)cyclohexene-1-carbonyl]phenyl]methyl]amino]-2-oxoethoxy]propyl formate (PubChem CID 159894736) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is methane;3-[2-[methyl-[[4-[2-(methylamino)cyclohexene-1-carbonyl]phenyl]methyl]amino]-2-oxoethoxy]propyl formate.
| Compound Name | methane;3-[2-[methyl-[[4-[2-(methylamino)cyclohexene-1-carbonyl]phenyl]methyl]amino]-2-oxoethoxy]propyl formate |
|---|---|
| PubChem CID | 159894736 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | methane;3-[2-[methyl-[[4-[2-(methylamino)cyclohexene-1-carbonyl]phenyl]methyl]amino]-2-oxoethoxy]propyl formate |
| SMILES | C.CNC1=C(C(=O)c2ccc(CN(C)C(=O)COCCCOC=O)cc2)CCCC1 |
| InChI | InChI=1S/C22H30N2O5.CH4/c1-23-20-7-4-3-6-19(20)22(27)18-10-8-17(9-11-18)14-24(2)21(26)15-28-12-5-13-29-16-25;/h8-11,16,23H,3-7,12-15H2,1-2H3;1H4 |
| InChIKey | NVEUPMGBNROZGY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|