C25H34N2O6S — CID 143632740
ethyl 4-[[[2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]acetyl]-methylamino]methyl]benzoate (PubChem CID 143632740) has the molecular formula C25H34N2O6S and a molecular weight of 490.62 g/mol. Its IUPAC name is ethyl 4-[[[2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]acetyl]-methylamino]methyl]benzoate.
| Compound Name | ethyl 4-[[[2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]acetyl]-methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 143632740 |
| Molecular Formula | C25H34N2O6S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | ethyl 4-[[[2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]acetyl]-methylamino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN(C)C(=O)COCCN(C)S(=O)c2c(C)cc(OC)cc2C)cc1 |
| InChI | InChI=1S/C25H34N2O6S/c1-7-33-25(29)21-10-8-20(9-11-21)16-26(4)23(28)17-32-13-12-27(5)34(30)24-18(2)14-22(31-6)15-19(24)3/h8-11,14-15H,7,12-13,16-17H2,1-6H3 |
| InChIKey | ADSQSJPIXUHWOY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|