C27H42N4O4S — CID 143632013
N-[[4-[2-(dimethylamino)ethyl-methylamino]phenyl]methyl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]-N-methylacetamide (PubChem CID 143632013) has the molecular formula C27H42N4O4S and a molecular weight of 518.72 g/mol. Its IUPAC name is N-[[4-[2-(dimethylamino)ethyl-methylamino]phenyl]methyl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]-N-methylacetamide.
| Compound Name | N-[[4-[2-(dimethylamino)ethyl-methylamino]phenyl]methyl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 143632013 |
| Molecular Formula | C27H42N4O4S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | N-[[4-[2-(dimethylamino)ethyl-methylamino]phenyl]methyl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]-N-methylacetamide |
| SMILES | COc1cc(C)c(S(=O)N(C)CCOCC(=O)N(C)Cc2ccc(N(C)CCN(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C27H42N4O4S/c1-21-17-25(34-8)18-22(2)27(21)36(33)31(7)15-16-35-20-26(32)30(6)19-23-9-11-24(12-10-23)29(5)14-13-28(3)4/h9-12,17-18H,13-16,19-20H2,1-8H3 |
| InChIKey | OPSQFDCDHVPMEK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|